C9H13NO6 — CID 67190469
dimethyl 4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrole-4,6-dicarboxylate (PubChem CID 67190469) has the molecular formula C9H13NO6 and a molecular weight of 231.20 g/mol. Its IUPAC name is dimethyl 4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrole-4,6-dicarboxylate.
| Compound Name | dimethyl 4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrole-4,6-dicarboxylate |
|---|---|
| PubChem CID | 67190469 |
| Molecular Formula | C9H13NO6 |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | dimethyl 4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrole-4,6-dicarboxylate |
| SMILES | COC(=O)C1NC(C(=O)OC)C2OCOC12 |
| InChI | InChI=1S/C9H13NO6/c1-13-8(11)4-6-7(16-3-15-6)5(10-4)9(12)14-2/h4-7,10H,3H2,1-2H3 |
| InChIKey | YANMKOIGFXOAFD-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |