C9H17Gd2N3O2-2 — CID 58601951
N-[2-[2-(acetylamino)ethyl-methylamino]ethyl]acetamide;gadolinium (PubChem CID 58601951) has the molecular formula C9H17Gd2N3O2-2 and a molecular weight of 513.75 g/mol. Its IUPAC name is N-[2-[2-(acetylamino)ethyl-methylamino]ethyl]acetamide;gadolinium.
| Compound Name | N-[2-[2-(acetylamino)ethyl-methylamino]ethyl]acetamide;gadolinium |
|---|---|
| PubChem CID | 58601951 |
| Molecular Formula | C9H17Gd2N3O2-2 |
| Molecular Weight | 513.75 g/mol |
| Exact Mass | 514.98 |
| IUPAC Name | N-[2-[2-(acetylamino)ethyl-methylamino]ethyl]acetamide;gadolinium |
| SMILES | [CH2-]C(=O)NCCN(C)CCNC([CH2-])=O.[Gd].[Gd] |
| InChI | InChI=1S/C9H17N3O2.2Gd/c1-8(13)10-4-6-12(3)7-5-11-9(2)14;;/h1-2,4-7H2,3H3,(H,10,13)(H,11,14);;/q-2;; |
| InChIKey | HSNPOWCTXGRUKW-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.75 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|