C23H23NO6S3 — CID 58608006
2-(2-oxopropyldisulfanyl)ethyl 2-[4-(5-methyl-4-phenyl-1,2-oxazol-3-yl)phenyl]sulfonylacetate (PubChem CID 58608006) has the molecular formula C23H23NO6S3 and a molecular weight of 505.64 g/mol. Its IUPAC name is 2-(2-oxopropyldisulfanyl)ethyl 2-[4-(5-methyl-4-phenyl-1,2-oxazol-3-yl)phenyl]sulfonylacetate.
| Compound Name | 2-(2-oxopropyldisulfanyl)ethyl 2-[4-(5-methyl-4-phenyl-1,2-oxazol-3-yl)phenyl]sulfonylacetate |
|---|---|
| PubChem CID | 58608006 |
| Molecular Formula | C23H23NO6S3 |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | 2-(2-oxopropyldisulfanyl)ethyl 2-[4-(5-methyl-4-phenyl-1,2-oxazol-3-yl)phenyl]sulfonylacetate |
| SMILES | CC(=O)CSSCCOC(=O)CS(=O)(=O)c1ccc(-c2noc(C)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23NO6S3/c1-16(25)14-32-31-13-12-29-21(26)15-33(27,28)20-10-8-19(9-11-20)23-22(17(2)30-24-23)18-6-4-3-5-7-18/h3-11H,12-15H2,1-2H3 |
| InChIKey | SGNRVLRQRSMPMA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 103.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|