C26H29N3O8S3 — CID 58608030
2-methyl-4-[2-[2-[[4-(5-methyl-4-phenyl-1,2-oxazol-3-yl)phenyl]sulfonylcarbamoyloxy]ethyldisulfanyl]ethylamino]-4-oxobutanoic acid (PubChem CID 58608030) has the molecular formula C26H29N3O8S3 and a molecular weight of 607.73 g/mol. Its IUPAC name is 2-methyl-4-[2-[2-[[4-(5-methyl-4-phenyl-1,2-oxazol-3-yl)phenyl]sulfonylcarbamoyloxy]ethyldisulfanyl]ethylamino]-4-oxobutanoic acid.
| Compound Name | 2-methyl-4-[2-[2-[[4-(5-methyl-4-phenyl-1,2-oxazol-3-yl)phenyl]sulfonylcarbamoyloxy]ethyldisulfanyl]ethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 58608030 |
| Molecular Formula | C26H29N3O8S3 |
| Molecular Weight | 607.73 g/mol |
| Exact Mass | 607.11 |
| IUPAC Name | 2-methyl-4-[2-[2-[[4-(5-methyl-4-phenyl-1,2-oxazol-3-yl)phenyl]sulfonylcarbamoyloxy]ethyldisulfanyl]ethylamino]-4-oxobutanoic acid |
| SMILES | Cc1onc(-c2ccc(S(=O)(=O)NC(=O)OCCSSCCNC(=O)CC(C)C(=O)O)cc2)c1-c1ccccc1 |
| InChI | InChI=1S/C26H29N3O8S3/c1-17(25(31)32)16-22(30)27-12-14-38-39-15-13-36-26(33)29-40(34,35)21-10-8-20(9-11-21)24-23(18(2)37-28-24)19-6-4-3-5-7-19/h3-11,17H,12-16H2,1-2H3,(H,27,30)(H,29,33)(H,31,32) |
| InChIKey | GNILLBTWFBETGA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 164.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.73 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|