C24H19N3O8S — CID 10346209
[3-(nitrooxymethyl)phenyl] N-[4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)phenyl]sulfonylcarbamate (PubChem CID 10346209) has the molecular formula C24H19N3O8S and a molecular weight of 509.50 g/mol. Its IUPAC name is [3-(nitrooxymethyl)phenyl] N-[4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)phenyl]sulfonylcarbamate.
| Compound Name | [3-(nitrooxymethyl)phenyl] N-[4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)phenyl]sulfonylcarbamate |
|---|---|
| PubChem CID | 10346209 |
| Molecular Formula | C24H19N3O8S |
| Molecular Weight | 509.50 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | [3-(nitrooxymethyl)phenyl] N-[4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)phenyl]sulfonylcarbamate |
| SMILES | Cc1onc(-c2ccccc2)c1-c1ccc(S(=O)(=O)NC(=O)Oc2cccc(CO[N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C24H19N3O8S/c1-16-22(23(25-35-16)19-7-3-2-4-8-19)18-10-12-21(13-11-18)36(31,32)26-24(28)34-20-9-5-6-17(14-20)15-33-27(29)30/h2-14H,15H2,1H3,(H,26,28) |
| InChIKey | XERROHWVTRADMN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 150.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|