C21H22N4O8S3 — CID 89391120
2-(2-nitrooxyethyldisulfanyl)ethyl N-amino-N-[4-(5-methyl-4-phenyl-1,2-oxazol-3-yl)phenyl]sulfonylcarbamate (PubChem CID 89391120) has the molecular formula C21H22N4O8S3 and a molecular weight of 554.63 g/mol. Its IUPAC name is 2-(2-nitrooxyethyldisulfanyl)ethyl N-amino-N-[4-(5-methyl-4-phenyl-1,2-oxazol-3-yl)phenyl]sulfonylcarbamate.
| Compound Name | 2-(2-nitrooxyethyldisulfanyl)ethyl N-amino-N-[4-(5-methyl-4-phenyl-1,2-oxazol-3-yl)phenyl]sulfonylcarbamate |
|---|---|
| PubChem CID | 89391120 |
| Molecular Formula | C21H22N4O8S3 |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.06 |
| IUPAC Name | 2-(2-nitrooxyethyldisulfanyl)ethyl N-amino-N-[4-(5-methyl-4-phenyl-1,2-oxazol-3-yl)phenyl]sulfonylcarbamate |
| SMILES | Cc1onc(-c2ccc(S(=O)(=O)N(N)C(=O)OCCSSCCO[N+](=O)[O-])cc2)c1-c1ccccc1 |
| InChI | InChI=1S/C21H22N4O8S3/c1-15-19(16-5-3-2-4-6-16)20(23-33-15)17-7-9-18(10-8-17)36(29,30)24(22)21(26)31-11-13-34-35-14-12-32-25(27)28/h2-10H,11-14,22H2,1H3 |
| InChIKey | FJUCQRHUKYNXHG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 168.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|