About phenyl pyridin-1-ium-1-yl carbonate
phenyl pyridin-1-ium-1-yl carbonate (PubChem CID 58609450) has the molecular formula C12H10NO3+
and a molecular weight of 216.22 g/mol. Its IUPAC name is phenyl pyridin-1-ium-1-yl carbonate.
Molecular Properties
| Compound Name | phenyl pyridin-1-ium-1-yl carbonate |
| PubChem CID | 58609450 |
| Molecular Formula | C12H10NO3+ |
| Molecular Weight | 216.22 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | phenyl pyridin-1-ium-1-yl carbonate |
| SMILES | O=C(Oc1ccccc1)O[n+]1ccccc1 |
| InChI | InChI=1S/C12H10NO3/c14-12(15-11-7-3-1-4-8-11)16-13-9-5-2-6-10-13/h1-10H/q+1 |
| InChIKey | BWHOUCOYZRSAME-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze phenyl pyridin-1-ium-1-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl pyridin-1-ium-1-yl carbonate?
The IUPAC name of phenyl pyridin-1-ium-1-yl carbonate (CID 58609450) is phenyl pyridin-1-ium-1-yl carbonate.
What is the SMILES notation for phenyl pyridin-1-ium-1-yl carbonate?
The canonical SMILES for phenyl pyridin-1-ium-1-yl carbonate is O=C(Oc1ccccc1)O[n+]1ccccc1.
What is the InChIKey of phenyl pyridin-1-ium-1-yl carbonate?
The InChIKey is BWHOUCOYZRSAME-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10NO3/c14-12(15-11-7-3-1-4-8-11)16-13-9-5-2-6-10-13/h1-10H/q+1.
What are the key properties of phenyl pyridin-1-ium-1-yl carbonate?
phenyl pyridin-1-ium-1-yl carbonate has a molecular weight of 216.22 g/mol, XLogP of 1.60, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl pyridin-1-ium-1-yl carbonate is sourced from PubChem (CID 58609450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).