About 1-(2,6-dimethylphenyl)-2-(2-thiophen-2-ylphenyl)prop-2-en-1-one
1-(2,6-dimethylphenyl)-2-(2-thiophen-2-ylphenyl)prop-2-en-1-one (PubChem CID 58615714) has the molecular formula C21H18OS
and a molecular weight of 318.44 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-2-(2-thiophen-2-ylphenyl)prop-2-en-1-one.
Molecular Properties
| Compound Name | 1-(2,6-dimethylphenyl)-2-(2-thiophen-2-ylphenyl)prop-2-en-1-one |
| PubChem CID | 58615714 |
| Molecular Formula | C21H18OS |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-2-(2-thiophen-2-ylphenyl)prop-2-en-1-one |
| SMILES | C=C(C(=O)c1c(C)cccc1C)c1ccccc1-c1cccs1 |
| InChI | InChI=1S/C21H18OS/c1-14-8-6-9-15(2)20(14)21(22)16(3)17-10-4-5-11-18(17)19-12-7-13-23-19/h4-13H,3H2,1-2H3 |
| InChIKey | KJCNXQKAFFEKNV-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,6-dimethylphenyl)-2-(2-thiophen-2-ylphenyl)prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6-dimethylphenyl)-2-(2-thiophen-2-ylphenyl)prop-2-en-1-one?
The IUPAC name of 1-(2,6-dimethylphenyl)-2-(2-thiophen-2-ylphenyl)prop-2-en-1-one (CID 58615714) is 1-(2,6-dimethylphenyl)-2-(2-thiophen-2-ylphenyl)prop-2-en-1-one.
What is the SMILES notation for 1-(2,6-dimethylphenyl)-2-(2-thiophen-2-ylphenyl)prop-2-en-1-one?
The canonical SMILES for 1-(2,6-dimethylphenyl)-2-(2-thiophen-2-ylphenyl)prop-2-en-1-one is C=C(C(=O)c1c(C)cccc1C)c1ccccc1-c1cccs1.
What is the InChIKey of 1-(2,6-dimethylphenyl)-2-(2-thiophen-2-ylphenyl)prop-2-en-1-one?
The InChIKey is KJCNXQKAFFEKNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18OS/c1-14-8-6-9-15(2)20(14)21(22)16(3)17-10-4-5-11-18(17)19-12-7-13-23-19/h4-13H,3H2,1-2H3.
What are the key properties of 1-(2,6-dimethylphenyl)-2-(2-thiophen-2-ylphenyl)prop-2-en-1-one?
1-(2,6-dimethylphenyl)-2-(2-thiophen-2-ylphenyl)prop-2-en-1-one has a molecular weight of 318.44 g/mol, XLogP of 5.93, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-dimethylphenyl)-2-(2-thiophen-2-ylphenyl)prop-2-en-1-one is sourced from PubChem (CID 58615714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).