C23H25NO4 — CID 58625510
4-[2-(5,6-dimethoxy-3-methyl-4-phenylmethoxy-2-pyridinyl)ethyl]phenol (PubChem CID 58625510) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is 4-[2-(5,6-dimethoxy-3-methyl-4-phenylmethoxy-2-pyridinyl)ethyl]phenol.
| Compound Name | 4-[2-(5,6-dimethoxy-3-methyl-4-phenylmethoxy-2-pyridinyl)ethyl]phenol |
|---|---|
| PubChem CID | 58625510 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 4-[2-(5,6-dimethoxy-3-methyl-4-phenylmethoxy-2-pyridinyl)ethyl]phenol |
| SMILES | COc1nc(CCc2ccc(O)cc2)c(C)c(OCc2ccccc2)c1OC |
| InChI | InChI=1S/C23H25NO4/c1-16-20(14-11-17-9-12-19(25)13-10-17)24-23(27-3)22(26-2)21(16)28-15-18-7-5-4-6-8-18/h4-10,12-13,25H,11,14-15H2,1-3H3 |
| InChIKey | WUOVQVCZFYOGIB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |