C39H48O7 — CID 71624549
5-[10-[4,5-dimethoxy-2-methyl-3,6-bis(phenylmethoxy)phenyl]decoxy]benzene-1,3-diol (PubChem CID 71624549) has the molecular formula C39H48O7 and a molecular weight of 628.81 g/mol. Its IUPAC name is 5-[10-[4,5-dimethoxy-2-methyl-3,6-bis(phenylmethoxy)phenyl]decoxy]benzene-1,3-diol.
| Compound Name | 5-[10-[4,5-dimethoxy-2-methyl-3,6-bis(phenylmethoxy)phenyl]decoxy]benzene-1,3-diol |
|---|---|
| PubChem CID | 71624549 |
| Molecular Formula | C39H48O7 |
| Molecular Weight | 628.81 g/mol |
| Exact Mass | 628.34 |
| IUPAC Name | 5-[10-[4,5-dimethoxy-2-methyl-3,6-bis(phenylmethoxy)phenyl]decoxy]benzene-1,3-diol |
| SMILES | COc1c(OCc2ccccc2)c(C)c(CCCCCCCCCCOc2cc(O)cc(O)c2)c(OCc2ccccc2)c1OC |
| InChI | InChI=1S/C39H48O7/c1-29-35(22-16-8-6-4-5-7-9-17-23-44-34-25-32(40)24-33(41)26-34)37(46-28-31-20-14-11-15-21-31)39(43-3)38(42-2)36(29)45-27-30-18-12-10-13-19-30/h10-15,18-21,24-26,40-41H,4-9,16-17,22-23,27-28H2,1-3H3 |
| InChIKey | RAWLBWPWUBOYDF-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.81 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|