C57H61N3O10 — CID 58627433
5-azido-4-phenylmethoxy-2-(phenylmethoxymethyl)-6-[2,3,4,5-tetrakis(phenylmethoxy)-6-prop-2-enoxycyclohexyl]oxyoxan-3-ol (PubChem CID 58627433) has the molecular formula C57H61N3O10 and a molecular weight of 948.13 g/mol. Its IUPAC name is 5-azido-4-phenylmethoxy-2-(phenylmethoxymethyl)-6-[2,3,4,5-tetrakis(phenylmethoxy)-6-prop-2-enoxycyclohexyl]oxyoxan-3-ol.
| Compound Name | 5-azido-4-phenylmethoxy-2-(phenylmethoxymethyl)-6-[2,3,4,5-tetrakis(phenylmethoxy)-6-prop-2-enoxycyclohexyl]oxyoxan-3-ol |
|---|---|
| PubChem CID | 58627433 |
| Molecular Formula | C57H61N3O10 |
| Molecular Weight | 948.13 g/mol |
| Exact Mass | 947.44 |
| IUPAC Name | 5-azido-4-phenylmethoxy-2-(phenylmethoxymethyl)-6-[2,3,4,5-tetrakis(phenylmethoxy)-6-prop-2-enoxycyclohexyl]oxyoxan-3-ol |
| SMILES | C=CCOC1C(OCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C1OC1OC(COCc2ccccc2)C(O)C(OCc2ccccc2)C1N=[N+]=[N-] |
| InChI | InChI=1S/C57H61N3O10/c1-2-33-63-54-52(66-37-44-27-15-6-16-28-44)51(65-36-43-25-13-5-14-26-43)53(67-38-45-29-17-7-18-30-45)55(68-39-46-31-19-8-20-32-46)56(54)70-57-48(59-60-58)50(64-35-42-23-11-4-12-24-42)49(61)47(69-57)40-62-34-41-21-9-3-10-22-41/h2-32,47-57,61H,1,33-40H2 |
| InChIKey | ANSJGGDRUYMJQS-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 152.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 948.13 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|