C30H29N5O3 — CID 58633410
(4R)-3-[(2S,3S)-2-azido-3-[1-(2,4,6-trimethylphenyl)indol-3-yl]butanoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 58633410) has the molecular formula C30H29N5O3 and a molecular weight of 507.59 g/mol. Its IUPAC name is (4R)-3-[(2S,3S)-2-azido-3-[1-(2,4,6-trimethylphenyl)indol-3-yl]butanoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(2S,3S)-2-azido-3-[1-(2,4,6-trimethylphenyl)indol-3-yl]butanoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 58633410 |
| Molecular Formula | C30H29N5O3 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | (4R)-3-[(2S,3S)-2-azido-3-[1-(2,4,6-trimethylphenyl)indol-3-yl]butanoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | Cc1cc(C)c(-n2cc([C@H](C)[C@H](N=[N+]=[N-])C(=O)N3C(=O)OC[C@H]3c3ccccc3)c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C30H29N5O3/c1-18-14-19(2)28(20(3)15-18)34-16-24(23-12-8-9-13-25(23)34)21(4)27(32-33-31)29(36)35-26(17-38-30(35)37)22-10-6-5-7-11-22/h5-16,21,26-27H,17H2,1-4H3/t21-,26-,27-/m0/s1 |
| InChIKey | HOLGDRBIJPMJBU-PUUVEUEGSA-N |
| XLogP | 7.06 |
| TPSA | 100.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|