C19H28N2Si — CID 58634160
4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl-dimethyl-[(2S)-2-methylimidazolidin-1-yl]silane (PubChem CID 58634160) has the molecular formula C19H28N2Si and a molecular weight of 312.53 g/mol. Its IUPAC name is 4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl-dimethyl-[(2S)-2-methylimidazolidin-1-yl]silane.
| Compound Name | 4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl-dimethyl-[(2S)-2-methylimidazolidin-1-yl]silane |
|---|---|
| PubChem CID | 58634160 |
| Molecular Formula | C19H28N2Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl-dimethyl-[(2S)-2-methylimidazolidin-1-yl]silane |
| SMILES | C[C@H]1NCCN1[Si](C)(C)C1C2C=CC=CC2C2C=CC=CC21 |
| InChI | InChI=1S/C19H28N2Si/c1-14-20-12-13-21(14)22(2,3)19-17-10-6-4-8-15(17)16-9-5-7-11-18(16)19/h4-11,14-20H,12-13H2,1-3H3/t14-,15?,16?,17?,18?,19?/m0/s1 |
| InChIKey | SSNOSDLUSSGSES-QWEMWOLJSA-N |
| XLogP | 3.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|