C19H16Cl2N2O7S2 — CID 58635117
4-[2-[[1-(carboxymethyl)-5-chlorofuro[3,2-d][1,3]thiazol-1-ium-2-yl]methylidene]-5-chloro-1,3-benzoxazol-3-yl]butane-1-sulfonate (PubChem CID 58635117) has the molecular formula C19H16Cl2N2O7S2 and a molecular weight of 519.38 g/mol. Its IUPAC name is 4-[2-[[1-(carboxymethyl)-5-chlorofuro[3,2-d][1,3]thiazol-1-ium-2-yl]methylidene]-5-chloro-1,3-benzoxazol-3-yl]butane-1-sulfonate.
| Compound Name | 4-[2-[[1-(carboxymethyl)-5-chlorofuro[3,2-d][1,3]thiazol-1-ium-2-yl]methylidene]-5-chloro-1,3-benzoxazol-3-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 58635117 |
| Molecular Formula | C19H16Cl2N2O7S2 |
| Molecular Weight | 519.38 g/mol |
| Exact Mass | 517.98 |
| IUPAC Name | 4-[2-[[1-(carboxymethyl)-5-chlorofuro[3,2-d][1,3]thiazol-1-ium-2-yl]methylidene]-5-chloro-1,3-benzoxazol-3-yl]butane-1-sulfonate |
| SMILES | O=C(O)C[n+]1c(C=C2Oc3ccc(Cl)cc3N2CCCCS(=O)(=O)[O-])sc2oc(Cl)cc21 |
| InChI | InChI=1S/C19H16Cl2N2O7S2/c20-11-3-4-14-12(7-11)22(5-1-2-6-32(26,27)28)16(29-14)9-17-23(10-18(24)25)13-8-15(21)30-19(13)31-17/h3-4,7-9H,1-2,5-6,10H2,(H-,24,25,26,27,28) |
| InChIKey | MRTPTXWXCOBZSY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|