C16H14N4O — CID 58638363
3-but-2-ynyl-5-methyl-2-phenylimidazo[4,5-d]pyridazin-4-one (PubChem CID 58638363) has the molecular formula C16H14N4O and a molecular weight of 278.32 g/mol. Its IUPAC name is 3-but-2-ynyl-5-methyl-2-phenylimidazo[4,5-d]pyridazin-4-one.
| Compound Name | 3-but-2-ynyl-5-methyl-2-phenylimidazo[4,5-d]pyridazin-4-one |
|---|---|
| PubChem CID | 58638363 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 3-but-2-ynyl-5-methyl-2-phenylimidazo[4,5-d]pyridazin-4-one |
| SMILES | CC#CCn1c(-c2ccccc2)nc2cnn(C)c(=O)c21 |
| InChI | InChI=1S/C16H14N4O/c1-3-4-10-20-14-13(11-17-19(2)16(14)21)18-15(20)12-8-6-5-7-9-12/h5-9,11H,10H2,1-2H3 |
| InChIKey | WNJHLRHQHOYGLE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|