C21H18F2N2O5 — CID 58641495
methyl 2-fluoro-6-[3-fluoro-4-[[[(2E)-2-methyl-4-nitropenta-2,4-dienoyl]amino]methyl]phenyl]benzoate (PubChem CID 58641495) has the molecular formula C21H18F2N2O5 and a molecular weight of 416.38 g/mol. Its IUPAC name is methyl 2-fluoro-6-[3-fluoro-4-[[[(2E)-2-methyl-4-nitropenta-2,4-dienoyl]amino]methyl]phenyl]benzoate.
| Compound Name | methyl 2-fluoro-6-[3-fluoro-4-[[[(2E)-2-methyl-4-nitropenta-2,4-dienoyl]amino]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 58641495 |
| Molecular Formula | C21H18F2N2O5 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | methyl 2-fluoro-6-[3-fluoro-4-[[[(2E)-2-methyl-4-nitropenta-2,4-dienoyl]amino]methyl]phenyl]benzoate |
| SMILES | C=C(/C=C(\C)C(=O)NCc1ccc(-c2cccc(F)c2C(=O)OC)cc1F)[N+](=O)[O-] |
| InChI | InChI=1S/C21H18F2N2O5/c1-12(9-13(2)25(28)29)20(26)24-11-15-8-7-14(10-18(15)23)16-5-4-6-17(22)19(16)21(27)30-3/h4-10H,2,11H2,1,3H3,(H,24,26)/b12-9+ |
| InChIKey | OOZPXKGSXMJSGH-FMIVXFBMSA-N |
| XLogP | 3.77 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|