C24H34O2 — CID 58660468
7-[4-(4-propylcyclohexyl)cyclohexyl]-4H-chromen-3-one (PubChem CID 58660468) has the molecular formula C24H34O2 and a molecular weight of 354.53 g/mol. Its IUPAC name is 7-[4-(4-propylcyclohexyl)cyclohexyl]-4H-chromen-3-one.
| Compound Name | 7-[4-(4-propylcyclohexyl)cyclohexyl]-4H-chromen-3-one |
|---|---|
| PubChem CID | 58660468 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | 7-[4-(4-propylcyclohexyl)cyclohexyl]-4H-chromen-3-one |
| SMILES | CCCC1CCC(C2CCC(c3ccc4c(c3)OCC(=O)C4)CC2)CC1 |
| InChI | InChI=1S/C24H34O2/c1-2-3-17-4-6-18(7-5-17)19-8-10-20(11-9-19)21-12-13-22-14-23(25)16-26-24(22)15-21/h12-13,15,17-20H,2-11,14,16H2,1H3 |
| InChIKey | RSADQHREXDSAAW-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |