C23H25FO2 — CID 58660536
7-[4-(4-ethylcyclohexyl)-2-fluorophenyl]-4H-chromen-3-one (PubChem CID 58660536) has the molecular formula C23H25FO2 and a molecular weight of 352.45 g/mol. Its IUPAC name is 7-[4-(4-ethylcyclohexyl)-2-fluorophenyl]-4H-chromen-3-one.
| Compound Name | 7-[4-(4-ethylcyclohexyl)-2-fluorophenyl]-4H-chromen-3-one |
|---|---|
| PubChem CID | 58660536 |
| Molecular Formula | C23H25FO2 |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 7-[4-(4-ethylcyclohexyl)-2-fluorophenyl]-4H-chromen-3-one |
| SMILES | CCC1CCC(c2ccc(-c3ccc4c(c3)OCC(=O)C4)c(F)c2)CC1 |
| InChI | InChI=1S/C23H25FO2/c1-2-15-3-5-16(6-4-15)17-9-10-21(22(24)12-17)18-7-8-19-11-20(25)14-26-23(19)13-18/h7-10,12-13,15-16H,2-6,11,14H2,1H3 |
| InChIKey | HWXLGAYGFAPUCL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |