C11H21F2O5P — CID 58663099
(1,1-difluoro-2,2-dimethylpropyl)-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid (PubChem CID 58663099) has the molecular formula C11H21F2O5P and a molecular weight of 302.25 g/mol. Its IUPAC name is (1,1-difluoro-2,2-dimethylpropyl)-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid.
| Compound Name | (1,1-difluoro-2,2-dimethylpropyl)-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid |
|---|---|
| PubChem CID | 58663099 |
| Molecular Formula | C11H21F2O5P |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | (1,1-difluoro-2,2-dimethylpropyl)-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid |
| SMILES | CC(C)(C)C(=O)OCOP(=O)(O)C(F)(F)C(C)(C)C |
| InChI | InChI=1S/C11H21F2O5P/c1-9(2,3)8(14)17-7-18-19(15,16)11(12,13)10(4,5)6/h7H2,1-6H3,(H,15,16) |
| InChIKey | SYSIFMRRWSIPQU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|