C29H56ClN6O2- — CID 58668200
chloro-[(3S)-4-[[4-(methylaminomethyl)piperazin-1-yl]methylamino]-3-[[(Z)-octadec-9-enoyl]amino]-4-oxobutyl]azanide (PubChem CID 58668200) has the molecular formula C29H56ClN6O2- and a molecular weight of 556.26 g/mol. Its IUPAC name is chloro-[(3S)-4-[[4-(methylaminomethyl)piperazin-1-yl]methylamino]-3-[[(Z)-octadec-9-enoyl]amino]-4-oxobutyl]azanide.
| Compound Name | chloro-[(3S)-4-[[4-(methylaminomethyl)piperazin-1-yl]methylamino]-3-[[(Z)-octadec-9-enoyl]amino]-4-oxobutyl]azanide |
|---|---|
| PubChem CID | 58668200 |
| Molecular Formula | C29H56ClN6O2- |
| Molecular Weight | 556.26 g/mol |
| Exact Mass | 555.42 |
| IUPAC Name | chloro-[(3S)-4-[[4-(methylaminomethyl)piperazin-1-yl]methylamino]-3-[[(Z)-octadec-9-enoyl]amino]-4-oxobutyl]azanide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@@H](CC[N-]Cl)C(=O)NCN1CCN(CNC)CC1 |
| InChI | InChI=1S/C29H56ClN6O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-28(37)34-27(19-20-33-30)29(38)32-26-36-23-21-35(22-24-36)25-31-2/h10-11,27,31H,3-9,12-26H2,1-2H3,(H,32,38)(H,34,37)/q-1/b11-10-/t27-/m0/s1 |
| InChIKey | VHLYYIHRFVFLQT-UZFIPDPJSA-N |
| XLogP | 5.29 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.26 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|