C29H57ClN6O2 — CID 58668201
(Z)-N-[(2S)-4-(chloroamino)-1-[[4-(methylaminomethyl)piperazin-1-yl]methylamino]-1-oxobutan-2-yl]octadec-9-enamide (PubChem CID 58668201) has the molecular formula C29H57ClN6O2 and a molecular weight of 557.27 g/mol. Its IUPAC name is (Z)-N-[(2S)-4-(chloroamino)-1-[[4-(methylaminomethyl)piperazin-1-yl]methylamino]-1-oxobutan-2-yl]octadec-9-enamide.
| Compound Name | (Z)-N-[(2S)-4-(chloroamino)-1-[[4-(methylaminomethyl)piperazin-1-yl]methylamino]-1-oxobutan-2-yl]octadec-9-enamide |
|---|---|
| PubChem CID | 58668201 |
| Molecular Formula | C29H57ClN6O2 |
| Molecular Weight | 557.27 g/mol |
| Exact Mass | 556.42 |
| IUPAC Name | (Z)-N-[(2S)-4-(chloroamino)-1-[[4-(methylaminomethyl)piperazin-1-yl]methylamino]-1-oxobutan-2-yl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@@H](CCNCl)C(=O)NCN1CCN(CNC)CC1 |
| InChI | InChI=1S/C29H57ClN6O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-28(37)34-27(19-20-33-30)29(38)32-26-36-23-21-35(22-24-36)25-31-2/h10-11,27,31,33H,3-9,12-26H2,1-2H3,(H,32,38)(H,34,37)/b11-10-/t27-/m0/s1 |
| InChIKey | KMWZUSBCFYKFAD-UZFIPDPJSA-N |
| XLogP | 4.51 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.27 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|