C13H27N2O3S2Y- — CID 58682524
[[(2R)-4-methylsulfanyl-1-oxobutan-2-yl]amino] (2S)-2-amino-4-methylsulfanylbutanoate;propane;yttrium (PubChem CID 58682524) has the molecular formula C13H27N2O3S2Y- and a molecular weight of 412.41 g/mol. Its IUPAC name is [[(2R)-4-methylsulfanyl-1-oxobutan-2-yl]amino] (2S)-2-amino-4-methylsulfanylbutanoate;propane;yttrium.
| Compound Name | [[(2R)-4-methylsulfanyl-1-oxobutan-2-yl]amino] (2S)-2-amino-4-methylsulfanylbutanoate;propane;yttrium |
|---|---|
| PubChem CID | 58682524 |
| Molecular Formula | C13H27N2O3S2Y- |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | [[(2R)-4-methylsulfanyl-1-oxobutan-2-yl]amino] (2S)-2-amino-4-methylsulfanylbutanoate;propane;yttrium |
| SMILES | CSCC[C@H](C=O)NOC(=O)[C@@H](N)CCSC.[CH2-]CC.[Y] |
| InChI | InChI=1S/C10H20N2O3S2.C3H7.Y/c1-16-5-3-8(7-13)12-15-10(14)9(11)4-6-17-2;1-3-2;/h7-9,12H,3-6,11H2,1-2H3;1,3H2,2H3;/q;-1;/t8-,9+;;/m1../s1 |
| InChIKey | YGWMEUQNGNVFDC-BPRGXCPLSA-N |
| XLogP | 1.66 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|