C7H15N — CID 58700170
1,4-dimethyl-2,2,6,6-tetratritiopiperidine (PubChem CID 58700170) has the molecular formula C7H15N and a molecular weight of 121.24 g/mol. Its IUPAC name is 1,4-dimethyl-2,2,6,6-tetratritiopiperidine.
| Compound Name | 1,4-dimethyl-2,2,6,6-tetratritiopiperidine |
|---|---|
| PubChem CID | 58700170 |
| Molecular Formula | C7H15N |
| Molecular Weight | 121.24 g/mol |
| Exact Mass | 121.15 |
| IUPAC Name | 1,4-dimethyl-2,2,6,6-tetratritiopiperidine |
| SMILES | [3H]C1([3H])CC(C)CC([3H])([3H])N1C |
| InChI | InChI=1S/C7H15N/c1-7-3-5-8(2)6-4-7/h7H,3-6H2,1-2H3/i5T2,6T2 |
| InChIKey | TVSMLBGFGKLKOO-ANIAUBKNSA-N |
| XLogP | 1.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |