C31H32O4 — CID 58708545
1-O-methyl 4-O-(4,4',5,6,6'-pentamethyl-3,3'-spirobi[1,2-dihydroindene]-5'-yl) benzene-1,4-dicarboxylate (PubChem CID 58708545) has the molecular formula C31H32O4 and a molecular weight of 468.59 g/mol. Its IUPAC name is 1-O-methyl 4-O-(4,4',5,6,6'-pentamethyl-3,3'-spirobi[1,2-dihydroindene]-5'-yl) benzene-1,4-dicarboxylate.
| Compound Name | 1-O-methyl 4-O-(4,4',5,6,6'-pentamethyl-3,3'-spirobi[1,2-dihydroindene]-5'-yl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 58708545 |
| Molecular Formula | C31H32O4 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 1-O-methyl 4-O-(4,4',5,6,6'-pentamethyl-3,3'-spirobi[1,2-dihydroindene]-5'-yl) benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)Oc2c(C)cc3c(c2C)C2(CCc4cc(C)c(C)c(C)c42)CC3)cc1 |
| InChI | InChI=1S/C31H32O4/c1-17-15-24-11-13-31(26(24)20(4)19(17)3)14-12-25-16-18(2)28(21(5)27(25)31)35-30(33)23-9-7-22(8-10-23)29(32)34-6/h7-10,15-16H,11-14H2,1-6H3 |
| InChIKey | LAULJHMTOCTFDQ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|