C28H18N2Na2O8S2 — CID 58716201
disodium;8-[[4-[(8-oxidoperoxysulfanylnaphthalen-1-yl)carbamoyl]benzoyl]amino]naphthalene-1-sulfonate (PubChem CID 58716201) has the molecular formula C28H18N2Na2O8S2 and a molecular weight of 620.57 g/mol. Its IUPAC name is disodium;8-[[4-[(8-oxidoperoxysulfanylnaphthalen-1-yl)carbamoyl]benzoyl]amino]naphthalene-1-sulfonate.
| Compound Name | disodium;8-[[4-[(8-oxidoperoxysulfanylnaphthalen-1-yl)carbamoyl]benzoyl]amino]naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 58716201 |
| Molecular Formula | C28H18N2Na2O8S2 |
| Molecular Weight | 620.57 g/mol |
| Exact Mass | 620.03 |
| IUPAC Name | disodium;8-[[4-[(8-oxidoperoxysulfanylnaphthalen-1-yl)carbamoyl]benzoyl]amino]naphthalene-1-sulfonate |
| SMILES | O=C(Nc1cccc2cccc(SOO[O-])c12)c1ccc(C(=O)Nc2cccc3cccc(S(=O)(=O)[O-])c23)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C28H20N2O8S2.2Na/c31-27(29-21-9-1-5-17-7-3-11-23(25(17)21)39-38-37-33)19-13-15-20(16-14-19)28(32)30-22-10-2-6-18-8-4-12-24(26(18)22)40(34,35)36;;/h1-16,33H,(H,29,31)(H,30,32)(H,34,35,36);;/q;2*+1/p-2 |
| InChIKey | IGMFVVHTEGJCON-UHFFFAOYSA-L |
| XLogP | -1.36 |
| TPSA | 156.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.57 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|