C30H37NO6S — CID 142920256
8-[[4-[6,6-dimethyl-3-[(2-methylpropan-2-yl)oxy]-5-oxoheptyl]benzoyl]amino]naphthalene-1-sulfonic acid (PubChem CID 142920256) has the molecular formula C30H37NO6S and a molecular weight of 539.69 g/mol. Its IUPAC name is 8-[[4-[6,6-dimethyl-3-[(2-methylpropan-2-yl)oxy]-5-oxoheptyl]benzoyl]amino]naphthalene-1-sulfonic acid.
| Compound Name | 8-[[4-[6,6-dimethyl-3-[(2-methylpropan-2-yl)oxy]-5-oxoheptyl]benzoyl]amino]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 142920256 |
| Molecular Formula | C30H37NO6S |
| Molecular Weight | 539.69 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | 8-[[4-[6,6-dimethyl-3-[(2-methylpropan-2-yl)oxy]-5-oxoheptyl]benzoyl]amino]naphthalene-1-sulfonic acid |
| SMILES | CC(C)(C)OC(CCc1ccc(C(=O)Nc2cccc3cccc(S(=O)(=O)O)c23)cc1)CC(=O)C(C)(C)C |
| InChI | InChI=1S/C30H37NO6S/c1-29(2,3)26(32)19-23(37-30(4,5)6)18-15-20-13-16-22(17-14-20)28(33)31-24-11-7-9-21-10-8-12-25(27(21)24)38(34,35)36/h7-14,16-17,23H,15,18-19H2,1-6H3,(H,31,33)(H,34,35,36) |
| InChIKey | NJFVFFGIODGOGW-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.69 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|