C8H8NOY- — CID 58717463
2,3-dihydro-1H-indolizin-1-id-5-one;yttrium (PubChem CID 58717463) has the molecular formula C8H8NOY- and a molecular weight of 223.06 g/mol. Its IUPAC name is 2,3-dihydro-1H-indolizin-1-id-5-one;yttrium.
| Compound Name | 2,3-dihydro-1H-indolizin-1-id-5-one;yttrium |
|---|---|
| PubChem CID | 58717463 |
| Molecular Formula | C8H8NOY- |
| Molecular Weight | 223.06 g/mol |
| Exact Mass | 222.97 |
| IUPAC Name | 2,3-dihydro-1H-indolizin-1-id-5-one;yttrium |
| SMILES | O=c1cccc2n1CC[CH-]2.[Y] |
| InChI | InChI=1S/C8H8NO.Y/c10-8-5-1-3-7-4-2-6-9(7)8;/h1,3-5H,2,6H2;/q-1; |
| InChIKey | YZKNZTYRFIBXDH-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.06 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|