About (2S)-2-formamido-N'-hydroxy-N-methyloctanediamide
(2S)-2-formamido-N'-hydroxy-N-methyloctanediamide (PubChem CID 58720884) has the molecular formula C10H19N3O4
and a molecular weight of 245.28 g/mol. Its IUPAC name is (2S)-2-formamido-N'-hydroxy-N-methyloctanediamide.
Molecular Properties
| Compound Name | (2S)-2-formamido-N'-hydroxy-N-methyloctanediamide |
| PubChem CID | 58720884 |
| Molecular Formula | C10H19N3O4 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (2S)-2-formamido-N'-hydroxy-N-methyloctanediamide |
| SMILES | CNC(=O)[C@H](CCCCCC(=O)NO)NC=O |
| InChI | InChI=1S/C10H19N3O4/c1-11-10(16)8(12-7-14)5-3-2-4-6-9(15)13-17/h7-8,17H,2-6H2,1H3,(H,11,16)(H,12,14)(H,13,15)/t8-/m0/s1 |
| InChIKey | QGTYZIHAZJBPGM-QMMMGPOBSA-N |
| XLogP | -0.70 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-formamido-N'-hydroxy-N-methyloctanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-formamido-N'-hydroxy-N-methyloctanediamide?
The IUPAC name of (2S)-2-formamido-N'-hydroxy-N-methyloctanediamide (CID 58720884) is (2S)-2-formamido-N'-hydroxy-N-methyloctanediamide.
What is the SMILES notation for (2S)-2-formamido-N'-hydroxy-N-methyloctanediamide?
The canonical SMILES for (2S)-2-formamido-N'-hydroxy-N-methyloctanediamide is CNC(=O)[C@H](CCCCCC(=O)NO)NC=O.
What is the InChIKey of (2S)-2-formamido-N'-hydroxy-N-methyloctanediamide?
The InChIKey is QGTYZIHAZJBPGM-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H19N3O4/c1-11-10(16)8(12-7-14)5-3-2-4-6-9(15)13-17/h7-8,17H,2-6H2,1H3,(H,11,16)(H,12,14)(H,13,15)/t8-/m0/s1.
What are the key properties of (2S)-2-formamido-N'-hydroxy-N-methyloctanediamide?
(2S)-2-formamido-N'-hydroxy-N-methyloctanediamide has a molecular weight of 245.28 g/mol, XLogP of -0.70, 9 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-formamido-N'-hydroxy-N-methyloctanediamide is sourced from PubChem (CID 58720884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).