C10H9N3O4S — CID 58721478
2-(4-methyl-5-sulfino-1,2,4-triazol-3-yl)benzoic acid (PubChem CID 58721478) has the molecular formula C10H9N3O4S and a molecular weight of 267.27 g/mol. Its IUPAC name is 2-(4-methyl-5-sulfino-1,2,4-triazol-3-yl)benzoic acid.
| Compound Name | 2-(4-methyl-5-sulfino-1,2,4-triazol-3-yl)benzoic acid |
|---|---|
| PubChem CID | 58721478 |
| Molecular Formula | C10H9N3O4S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 2-(4-methyl-5-sulfino-1,2,4-triazol-3-yl)benzoic acid |
| SMILES | Cn1c(-c2ccccc2C(=O)O)nnc1S(=O)O |
| InChI | InChI=1S/C10H9N3O4S/c1-13-8(11-12-10(13)18(16)17)6-4-2-3-5-7(6)9(14)15/h2-5H,1H3,(H,14,15)(H,16,17) |
| InChIKey | FJDJVCODKBLANV-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|