C26H29N3O7 — CID 58724403
benzyl 3-[[(2S)-1-methoxy-3-(4-nitrophenyl)-1-oxopropan-2-yl]carbamoyl]-2-azabicyclo[2.2.2]octane-2-carboxylate (PubChem CID 58724403) has the molecular formula C26H29N3O7 and a molecular weight of 495.53 g/mol. Its IUPAC name is benzyl 3-[[(2S)-1-methoxy-3-(4-nitrophenyl)-1-oxopropan-2-yl]carbamoyl]-2-azabicyclo[2.2.2]octane-2-carboxylate.
| Compound Name | benzyl 3-[[(2S)-1-methoxy-3-(4-nitrophenyl)-1-oxopropan-2-yl]carbamoyl]-2-azabicyclo[2.2.2]octane-2-carboxylate |
|---|---|
| PubChem CID | 58724403 |
| Molecular Formula | C26H29N3O7 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | benzyl 3-[[(2S)-1-methoxy-3-(4-nitrophenyl)-1-oxopropan-2-yl]carbamoyl]-2-azabicyclo[2.2.2]octane-2-carboxylate |
| SMILES | COC(=O)[C@H](Cc1ccc([N+](=O)[O-])cc1)NC(=O)C1C2CCC(CC2)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H29N3O7/c1-35-25(31)22(15-17-7-11-21(12-8-17)29(33)34)27-24(30)23-19-9-13-20(14-10-19)28(23)26(32)36-16-18-5-3-2-4-6-18/h2-8,11-12,19-20,22-23H,9-10,13-16H2,1H3,(H,27,30)/t19?,20?,22-,23?/m0/s1 |
| InChIKey | QXCVEDBRKIBYBA-HQQWZMMQSA-N |
| XLogP | 3.37 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|