C26H22IrN2S2 — CID 58725428
iridium;bis(2-phenyl-3a,7a-dihydro-1,3-benzothiazole) (PubChem CID 58725428) has the molecular formula C26H22IrN2S2 and a molecular weight of 618.83 g/mol. Its IUPAC name is iridium;bis(2-phenyl-3a,7a-dihydro-1,3-benzothiazole).
| Compound Name | iridium;bis(2-phenyl-3a,7a-dihydro-1,3-benzothiazole) |
|---|---|
| PubChem CID | 58725428 |
| Molecular Formula | C26H22IrN2S2 |
| Molecular Weight | 618.83 g/mol |
| Exact Mass | 619.09 |
| IUPAC Name | iridium;bis(2-phenyl-3a,7a-dihydro-1,3-benzothiazole) |
| SMILES | C1=CC2N=C(c3ccccc3)SC2C=C1.C1=CC2N=C(c3ccccc3)SC2C=C1.[Ir] |
| InChI | InChI=1S/2C13H11NS.Ir/c2*1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13;/h2*1-9,11-12H; |
| InChIKey | ZMWNBPLLFCESBP-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.83 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |