C16H19NOSSi — CID 101035865
(5-cyclopenta-2,4-dien-1-yl-3-phenyl-1,4,2-oxathiazol-5-yl)-trimethylsilane (PubChem CID 101035865) has the molecular formula C16H19NOSSi and a molecular weight of 301.49 g/mol. Its IUPAC name is (5-cyclopenta-2,4-dien-1-yl-3-phenyl-1,4,2-oxathiazol-5-yl)-trimethylsilane.
| Compound Name | (5-cyclopenta-2,4-dien-1-yl-3-phenyl-1,4,2-oxathiazol-5-yl)-trimethylsilane |
|---|---|
| PubChem CID | 101035865 |
| Molecular Formula | C16H19NOSSi |
| Molecular Weight | 301.49 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | (5-cyclopenta-2,4-dien-1-yl-3-phenyl-1,4,2-oxathiazol-5-yl)-trimethylsilane |
| SMILES | C[Si](C)(C)C1(C2C=CC=C2)ON=C(c2ccccc2)S1 |
| InChI | InChI=1S/C16H19NOSSi/c1-20(2,3)16(14-11-7-8-12-14)18-17-15(19-16)13-9-5-4-6-10-13/h4-12,14H,1-3H3 |
| InChIKey | FAKUOKGMELABBT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|