C13H15NO6S — CID 44517684
(6R,7S,8S,9R)-9-(hydroxymethyl)-3-phenyl-1,10-dioxa-4-thia-2-azaspiro[4.5]dec-2-ene-6,7,8-triol (PubChem CID 44517684) has the molecular formula C13H15NO6S and a molecular weight of 313.33 g/mol. Its IUPAC name is (6R,7S,8S,9R)-9-(hydroxymethyl)-3-phenyl-1,10-dioxa-4-thia-2-azaspiro[4.5]dec-2-ene-6,7,8-triol.
| Compound Name | (6R,7S,8S,9R)-9-(hydroxymethyl)-3-phenyl-1,10-dioxa-4-thia-2-azaspiro[4.5]dec-2-ene-6,7,8-triol |
|---|---|
| PubChem CID | 44517684 |
| Molecular Formula | C13H15NO6S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | (6R,7S,8S,9R)-9-(hydroxymethyl)-3-phenyl-1,10-dioxa-4-thia-2-azaspiro[4.5]dec-2-ene-6,7,8-triol |
| SMILES | OC[C@H]1OC2(ON=C(c3ccccc3)S2)C(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H15NO6S/c15-6-8-9(16)10(17)11(18)13(19-8)20-14-12(21-13)7-4-2-1-3-5-7/h1-5,8-11,15-18H,6H2/t8-,9-,10+,11?,13?/m1/s1 |
| InChIKey | BDDBEOZZUSMPQL-YLKBXCCFSA-N |
| XLogP | -0.76 |
| TPSA | 111.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |