C29H40F6O3 — CID 58734380
(2-propyl-2-bicyclo[2.2.1]heptanyl) 6-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2,2-dimethyloctanoate (PubChem CID 58734380) has the molecular formula C29H40F6O3 and a molecular weight of 550.62 g/mol. Its IUPAC name is (2-propyl-2-bicyclo[2.2.1]heptanyl) 6-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2,2-dimethyloctanoate.
| Compound Name | (2-propyl-2-bicyclo[2.2.1]heptanyl) 6-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2,2-dimethyloctanoate |
|---|---|
| PubChem CID | 58734380 |
| Molecular Formula | C29H40F6O3 |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | (2-propyl-2-bicyclo[2.2.1]heptanyl) 6-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2,2-dimethyloctanoate |
| SMILES | CCCC1(OC(=O)C(C)(C)CCCC(CC)c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)CC2CCC1C2 |
| InChI | InChI=1S/C29H40F6O3/c1-5-15-26(18-19-9-12-23(26)17-19)38-24(36)25(3,4)16-7-8-20(6-2)21-10-13-22(14-11-21)27(37,28(30,31)32)29(33,34)35/h10-11,13-14,19-20,23,37H,5-9,12,15-18H2,1-4H3 |
| InChIKey | JXQUPYFFVHGZOI-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |