C11H15F3O — CID 58736666
4-ethyl-2-[(2S)-1,1,1-trifluoro-3-methylbutan-2-yl]furan (PubChem CID 58736666) has the molecular formula C11H15F3O and a molecular weight of 220.23 g/mol. Its IUPAC name is 4-ethyl-2-[(2S)-1,1,1-trifluoro-3-methylbutan-2-yl]furan.
| Compound Name | 4-ethyl-2-[(2S)-1,1,1-trifluoro-3-methylbutan-2-yl]furan |
|---|---|
| PubChem CID | 58736666 |
| Molecular Formula | C11H15F3O |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 4-ethyl-2-[(2S)-1,1,1-trifluoro-3-methylbutan-2-yl]furan |
| SMILES | CCc1coc([C@H](C(C)C)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H15F3O/c1-4-8-5-9(15-6-8)10(7(2)3)11(12,13)14/h5-7,10H,4H2,1-3H3/t10-/m0/s1 |
| InChIKey | BFYNPIBSMOEYFM-JTQLQIEISA-N |
| XLogP | 4.14 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |