C24H25N3O5 — CID 58739050
hex-5-yn-3-yl N-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-N-methylcarbamate (PubChem CID 58739050) has the molecular formula C24H25N3O5 and a molecular weight of 435.48 g/mol. Its IUPAC name is hex-5-yn-3-yl N-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-N-methylcarbamate.
| Compound Name | hex-5-yn-3-yl N-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 58739050 |
| Molecular Formula | C24H25N3O5 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | hex-5-yn-3-yl N-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-N-methylcarbamate |
| SMILES | C#CCC(CC)OC(=O)N(C)c1ccc(Oc2ncnc3cc(OC)c(OC)cc23)cc1 |
| InChI | InChI=1S/C24H25N3O5/c1-6-8-17(7-2)32-24(28)27(3)16-9-11-18(12-10-16)31-23-19-13-21(29-4)22(30-5)14-20(19)25-15-26-23/h1,9-15,17H,7-8H2,2-5H3 |
| InChIKey | WXSWOZKMHVNUKF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 83.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|