C39H41O4+ — CID 58741800
2-[1-(2-tert-butyl-6-phenylpyran-4-ylidene)ethyl]-4-[1-(2-tert-butyl-6-phenylpyrylium-4-yl)ethylidene]-3-methoxycyclobut-2-en-1-one (PubChem CID 58741800) has the molecular formula C39H41O4+ and a molecular weight of 573.75 g/mol. Its IUPAC name is 2-[1-(2-tert-butyl-6-phenylpyran-4-ylidene)ethyl]-4-[1-(2-tert-butyl-6-phenylpyrylium-4-yl)ethylidene]-3-methoxycyclobut-2-en-1-one.
| Compound Name | 2-[1-(2-tert-butyl-6-phenylpyran-4-ylidene)ethyl]-4-[1-(2-tert-butyl-6-phenylpyrylium-4-yl)ethylidene]-3-methoxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 58741800 |
| Molecular Formula | C39H41O4+ |
| Molecular Weight | 573.75 g/mol |
| Exact Mass | 573.30 |
| IUPAC Name | 2-[1-(2-tert-butyl-6-phenylpyran-4-ylidene)ethyl]-4-[1-(2-tert-butyl-6-phenylpyrylium-4-yl)ethylidene]-3-methoxycyclobut-2-en-1-one |
| SMILES | COC1=C(C(C)=C2C=C(c3ccccc3)OC(C(C)(C)C)=C2)C(=O)C1=C(C)c1cc(-c2ccccc2)[o+]c(C(C)(C)C)c1 |
| InChI | InChI=1S/C39H41O4/c1-24(28-20-30(26-16-12-10-13-17-26)42-32(22-28)38(3,4)5)34-36(40)35(37(34)41-9)25(2)29-21-31(27-18-14-11-15-19-27)43-33(23-29)39(6,7)8/h10-23H,1-9H3/q+1 |
| InChIKey | OBHSZKOFQQIVMI-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 46.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.75 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|