C39H56N4O6Si — CID 58743586
9H-fluoren-9-ylmethyl (2S)-2-[(2S)-2-[[6-[3-[ethoxy(dimethyl)silyl]propylamino]-6-oxohexyl]-methylcarbamoyl]pyrrolidine-1-carbonyl]pyrrolidine-1-carboxylate (PubChem CID 58743586) has the molecular formula C39H56N4O6Si and a molecular weight of 704.99 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (2S)-2-[(2S)-2-[[6-[3-[ethoxy(dimethyl)silyl]propylamino]-6-oxohexyl]-methylcarbamoyl]pyrrolidine-1-carbonyl]pyrrolidine-1-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl (2S)-2-[(2S)-2-[[6-[3-[ethoxy(dimethyl)silyl]propylamino]-6-oxohexyl]-methylcarbamoyl]pyrrolidine-1-carbonyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58743586 |
| Molecular Formula | C39H56N4O6Si |
| Molecular Weight | 704.99 g/mol |
| Exact Mass | 704.40 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (2S)-2-[(2S)-2-[[6-[3-[ethoxy(dimethyl)silyl]propylamino]-6-oxohexyl]-methylcarbamoyl]pyrrolidine-1-carbonyl]pyrrolidine-1-carboxylate |
| SMILES | CCO[Si](C)(C)CCCNC(=O)CCCCCN(C)C(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C39H56N4O6Si/c1-5-49-50(3,4)27-15-23-40-36(44)22-7-6-12-24-41(2)37(45)34-20-13-25-42(34)38(46)35-21-14-26-43(35)39(47)48-28-33-31-18-10-8-16-29(31)30-17-9-11-19-32(30)33/h8-11,16-19,33-35H,5-7,12-15,20-28H2,1-4H3,(H,40,44)/t34-,35-/m0/s1 |
| InChIKey | PJGPUCXVJDIJRE-PXLJZGITSA-N |
| XLogP | 6.16 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.99 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|