C12H23O11S- — CID 58747851
[(2S,3R,4R,5R)-1-[(2R,3R,4R)-3,4-dihydroxy-2-(hydroxymethyl)cyclopentyl]-2,4,5,6-tetrahydroxyhexan-3-yl] sulfate (PubChem CID 58747851) has the molecular formula C12H23O11S- and a molecular weight of 375.37 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-1-[(2R,3R,4R)-3,4-dihydroxy-2-(hydroxymethyl)cyclopentyl]-2,4,5,6-tetrahydroxyhexan-3-yl] sulfate.
| Compound Name | [(2S,3R,4R,5R)-1-[(2R,3R,4R)-3,4-dihydroxy-2-(hydroxymethyl)cyclopentyl]-2,4,5,6-tetrahydroxyhexan-3-yl] sulfate |
|---|---|
| PubChem CID | 58747851 |
| Molecular Formula | C12H23O11S- |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | [(2S,3R,4R,5R)-1-[(2R,3R,4R)-3,4-dihydroxy-2-(hydroxymethyl)cyclopentyl]-2,4,5,6-tetrahydroxyhexan-3-yl] sulfate |
| SMILES | O=S(=O)([O-])O[C@@H]([C@H](O)[C@H](O)CO)[C@@H](O)CC1C[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C12H24O11S/c13-3-6-5(1-7(15)10(6)18)2-8(16)12(23-24(20,21)22)11(19)9(17)4-14/h5-19H,1-4H2,(H,20,21,22)/p-1/t5?,6-,7+,8-,9+,10+,11+,12+/m0/s1 |
| InChIKey | BKMWXMRHIJWUSQ-XCNKSWEUSA-M |
| XLogP | -4.35 |
| TPSA | 208.04 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | -4.35 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|