C12H24O8 — CID 58747771
(2R,3R,4R,5S)-6-[(1S,2R,3R,4R)-3,4-dihydroxy-2-(hydroxymethyl)cyclopentyl]hexane-1,2,3,4,5-pentol (PubChem CID 58747771) has the molecular formula C12H24O8 and a molecular weight of 296.32 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-[(1S,2R,3R,4R)-3,4-dihydroxy-2-(hydroxymethyl)cyclopentyl]hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5S)-6-[(1S,2R,3R,4R)-3,4-dihydroxy-2-(hydroxymethyl)cyclopentyl]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 58747771 |
| Molecular Formula | C12H24O8 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (2R,3R,4R,5S)-6-[(1S,2R,3R,4R)-3,4-dihydroxy-2-(hydroxymethyl)cyclopentyl]hexane-1,2,3,4,5-pentol |
| SMILES | OC[C@H]1[C@H](C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H24O8/c13-3-6-5(1-7(15)10(6)18)2-8(16)11(19)12(20)9(17)4-14/h5-20H,1-4H2/t5-,6-,7+,8-,9+,10+,11+,12+/m0/s1 |
| InChIKey | KRTJLPGZEVTTKO-UXHKCOPZSA-N |
| XLogP | -3.84 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | -3.84 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |