C13H26O12S2 — CID 140586888
[(2S,3S,4R,5R,6S)-1-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-4,5,6,7-tetrahydroxy-2-methoxyheptan-3-yl] sulfate (PubChem CID 140586888) has the molecular formula C13H26O12S2 and a molecular weight of 438.47 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6S)-1-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-4,5,6,7-tetrahydroxy-2-methoxyheptan-3-yl] sulfate.
| Compound Name | [(2S,3S,4R,5R,6S)-1-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-4,5,6,7-tetrahydroxy-2-methoxyheptan-3-yl] sulfate |
|---|---|
| PubChem CID | 140586888 |
| Molecular Formula | C13H26O12S2 |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | [(2S,3S,4R,5R,6S)-1-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-4,5,6,7-tetrahydroxy-2-methoxyheptan-3-yl] sulfate |
| SMILES | CO[C@H](C[S+]1C[C@@H](O)[C@H](O)[C@H]1CO)[C@@H](OS(=O)(=O)[O-])[C@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C13H26O12S2/c1-24-8(5-26-4-7(17)10(18)9(26)3-15)13(25-27(21,22)23)12(20)11(19)6(16)2-14/h6-20H,2-5H2,1H3/t6-,7+,8+,9+,10-,11+,12+,13+,26?/m0/s1 |
| InChIKey | BVJOLIQULVYGNZ-RVJLPMBWSA-N |
| XLogP | -5.36 |
| TPSA | 217.27 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | -5.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|