C13H26O12S2 — CID 177469576
[(2R,3R,4R,5S,6S)-1-[(2R,3R,4R)-3,4-dihydroxy-2-(hydroxymethyl)-1-sulfaniumylcyclopentyl]-2,4,5,6,7-pentahydroxyheptan-3-yl] sulfate (PubChem CID 177469576) has the molecular formula C13H26O12S2 and a molecular weight of 438.47 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-1-[(2R,3R,4R)-3,4-dihydroxy-2-(hydroxymethyl)-1-sulfaniumylcyclopentyl]-2,4,5,6,7-pentahydroxyheptan-3-yl] sulfate.
| Compound Name | [(2R,3R,4R,5S,6S)-1-[(2R,3R,4R)-3,4-dihydroxy-2-(hydroxymethyl)-1-sulfaniumylcyclopentyl]-2,4,5,6,7-pentahydroxyheptan-3-yl] sulfate |
|---|---|
| PubChem CID | 177469576 |
| Molecular Formula | C13H26O12S2 |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-1-[(2R,3R,4R)-3,4-dihydroxy-2-(hydroxymethyl)-1-sulfaniumylcyclopentyl]-2,4,5,6,7-pentahydroxyheptan-3-yl] sulfate |
| SMILES | O=S(=O)([O-])O[C@@H]([C@H](O)[C@@H](O)[C@@H](O)CO)[C@H](O)CC1([SH2+])C[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C13H26O12S2/c14-3-5-9(19)6(16)1-13(5,26)2-7(17)12(25-27(22,23)24)11(21)10(20)8(18)4-15/h5-12,14-21,26H,1-4H2,(H,22,23,24)/t5-,6-,7-,8+,9-,10+,11-,12-,13?/m1/s1 |
| InChIKey | ZHAKBOIWFQOUPA-TUQPBIRGSA-N |
| XLogP | -5.86 |
| TPSA | 228.27 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | -5.86 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|