C12H26NO11S+ — CID 101432900
[(2R,3R,4R)-3,4-dihydroxy-2-(hydroxymethyl)-1-[(2R,3S,4R,5S)-2,4,5,6-tetrahydroxy-3-sulfooxyhexyl]cyclopentyl]azanium (PubChem CID 101432900) has the molecular formula C12H26NO11S+ and a molecular weight of 392.40 g/mol. Its IUPAC name is [(2R,3R,4R)-3,4-dihydroxy-2-(hydroxymethyl)-1-[(2R,3S,4R,5S)-2,4,5,6-tetrahydroxy-3-sulfooxyhexyl]cyclopentyl]azanium.
| Compound Name | [(2R,3R,4R)-3,4-dihydroxy-2-(hydroxymethyl)-1-[(2R,3S,4R,5S)-2,4,5,6-tetrahydroxy-3-sulfooxyhexyl]cyclopentyl]azanium |
|---|---|
| PubChem CID | 101432900 |
| Molecular Formula | C12H26NO11S+ |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | [(2R,3R,4R)-3,4-dihydroxy-2-(hydroxymethyl)-1-[(2R,3S,4R,5S)-2,4,5,6-tetrahydroxy-3-sulfooxyhexyl]cyclopentyl]azanium |
| SMILES | [NH3+]C1(C[C@@H](O)[C@H](OS(=O)(=O)O)[C@H](O)[C@@H](O)CO)C[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C12H25NO11S/c13-12(1-6(16)9(19)5(12)3-14)2-7(17)11(24-25(21,22)23)10(20)8(18)4-15/h5-11,14-20H,1-4,13H2,(H,21,22,23)/p+1/t5-,6-,7-,8+,9-,10-,11+,12?/m1/s1 |
| InChIKey | VMANQLPHDYTSTK-BYYSVEBTSA-O |
| XLogP | -5.65 |
| TPSA | 232.85 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | -5.65 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|