C44H36O8S — CID 58750887
1-[4-[4-[2-[4-[4-[3-(4-methylbenzoyl)benzoyl]phenoxy]phenyl]propan-2-yl]phenoxy]-3-(trioxidanylsulfanyl)phenyl]ethanone (PubChem CID 58750887) has the molecular formula C44H36O8S and a molecular weight of 724.83 g/mol. Its IUPAC name is 1-[4-[4-[2-[4-[4-[3-(4-methylbenzoyl)benzoyl]phenoxy]phenyl]propan-2-yl]phenoxy]-3-(trioxidanylsulfanyl)phenyl]ethanone.
| Compound Name | 1-[4-[4-[2-[4-[4-[3-(4-methylbenzoyl)benzoyl]phenoxy]phenyl]propan-2-yl]phenoxy]-3-(trioxidanylsulfanyl)phenyl]ethanone |
|---|---|
| PubChem CID | 58750887 |
| Molecular Formula | C44H36O8S |
| Molecular Weight | 724.83 g/mol |
| Exact Mass | 724.21 |
| IUPAC Name | 1-[4-[4-[2-[4-[4-[3-(4-methylbenzoyl)benzoyl]phenoxy]phenyl]propan-2-yl]phenoxy]-3-(trioxidanylsulfanyl)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(Oc2ccc(C(C)(C)c3ccc(Oc4ccc(C(=O)c5cccc(C(=O)c6ccc(C)cc6)c5)cc4)cc3)cc2)c(SOOO)c1 |
| InChI | InChI=1S/C44H36O8S/c1-28-8-10-30(11-9-28)42(46)33-6-5-7-34(26-33)43(47)31-12-19-37(20-13-31)49-38-21-15-35(16-22-38)44(3,4)36-17-23-39(24-18-36)50-40-25-14-32(29(2)45)27-41(40)53-52-51-48/h5-27,48H,1-4H3 |
| InChIKey | SSNDSHOIZKQLEY-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.83 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|