C17H22FN3O2S — CID 58756859
N-[5-(2-amino-1,3-thiazol-4-yl)pentyl]-2-[(4-fluorophenyl)methoxy]acetamide (PubChem CID 58756859) has the molecular formula C17H22FN3O2S and a molecular weight of 351.45 g/mol. Its IUPAC name is N-[5-(2-amino-1,3-thiazol-4-yl)pentyl]-2-[(4-fluorophenyl)methoxy]acetamide.
| Compound Name | N-[5-(2-amino-1,3-thiazol-4-yl)pentyl]-2-[(4-fluorophenyl)methoxy]acetamide |
|---|---|
| PubChem CID | 58756859 |
| Molecular Formula | C17H22FN3O2S |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-[5-(2-amino-1,3-thiazol-4-yl)pentyl]-2-[(4-fluorophenyl)methoxy]acetamide |
| SMILES | Nc1nc(CCCCCNC(=O)COCc2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C17H22FN3O2S/c18-14-7-5-13(6-8-14)10-23-11-16(22)20-9-3-1-2-4-15-12-24-17(19)21-15/h5-8,12H,1-4,9-11H2,(H2,19,21)(H,20,22) |
| InChIKey | LQWXEZSUVNBDGZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|