C21H40O5Si — CID 58760982
methyl (3S,6R,7S,8R)-7-[tert-butyl(dimethyl)silyl]oxy-3,4,4,6,8-pentamethyl-5,9-dioxononanoate (PubChem CID 58760982) has the molecular formula C21H40O5Si and a molecular weight of 400.63 g/mol. Its IUPAC name is methyl (3S,6R,7S,8R)-7-[tert-butyl(dimethyl)silyl]oxy-3,4,4,6,8-pentamethyl-5,9-dioxononanoate.
| Compound Name | methyl (3S,6R,7S,8R)-7-[tert-butyl(dimethyl)silyl]oxy-3,4,4,6,8-pentamethyl-5,9-dioxononanoate |
|---|---|
| PubChem CID | 58760982 |
| Molecular Formula | C21H40O5Si |
| Molecular Weight | 400.63 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | methyl (3S,6R,7S,8R)-7-[tert-butyl(dimethyl)silyl]oxy-3,4,4,6,8-pentamethyl-5,9-dioxononanoate |
| SMILES | COC(=O)C[C@H](C)C(C)(C)C(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C=O |
| InChI | InChI=1S/C21H40O5Si/c1-14(13-22)18(26-27(10,11)20(4,5)6)16(3)19(24)21(7,8)15(2)12-17(23)25-9/h13-16,18H,12H2,1-11H3/t14-,15-,16+,18-/m0/s1 |
| InChIKey | NSKTWONOCPLILU-CUSZFKRNSA-N |
| XLogP | 4.64 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.63 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|