C22H44O5Si — CID 59550913
methyl (6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-11-hydroxy-4,4,6,8-tetramethyl-5-oxoundecanoate (PubChem CID 59550913) has the molecular formula C22H44O5Si and a molecular weight of 416.68 g/mol. Its IUPAC name is methyl (6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-11-hydroxy-4,4,6,8-tetramethyl-5-oxoundecanoate.
| Compound Name | methyl (6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-11-hydroxy-4,4,6,8-tetramethyl-5-oxoundecanoate |
|---|---|
| PubChem CID | 59550913 |
| Molecular Formula | C22H44O5Si |
| Molecular Weight | 416.68 g/mol |
| Exact Mass | 416.30 |
| IUPAC Name | methyl (6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-11-hydroxy-4,4,6,8-tetramethyl-5-oxoundecanoate |
| SMILES | COC(=O)CCC(C)(C)C(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CCCO |
| InChI | InChI=1S/C22H44O5Si/c1-16(12-11-15-23)19(27-28(9,10)21(3,4)5)17(2)20(25)22(6,7)14-13-18(24)26-8/h16-17,19,23H,11-15H2,1-10H3/t16-,17+,19-/m0/s1 |
| InChIKey | HQTITRVZIPXQSY-SCTDSRPQSA-N |
| XLogP | 4.97 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.68 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|