C9H8NY- — CID 58762958
6-methyl-3,7-dihydroindol-7-ide;yttrium (PubChem CID 58762958) has the molecular formula C9H8NY- and a molecular weight of 219.08 g/mol. Its IUPAC name is 6-methyl-3,7-dihydroindol-7-ide;yttrium.
| Compound Name | 6-methyl-3,7-dihydroindol-7-ide;yttrium |
|---|---|
| PubChem CID | 58762958 |
| Molecular Formula | C9H8NY- |
| Molecular Weight | 219.08 g/mol |
| Exact Mass | 218.97 |
| IUPAC Name | 6-methyl-3,7-dihydroindol-7-ide;yttrium |
| SMILES | Cc1[c-]c2c(cc1)CC=N2.[Y] |
| InChI | InChI=1S/C9H8N.Y/c1-7-2-3-8-4-5-10-9(8)6-7;/h2-3,5H,4H2,1H3;/q-1; |
| InChIKey | WUZIXZKUOOCYHC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.08 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|