About Se-(3-oxobutyl) pyridine-2-carboselenoate
Se-(3-oxobutyl) pyridine-2-carboselenoate (PubChem CID 58764813) has the molecular formula C10H11NO2Se
and a molecular weight of 256.16 g/mol. Its IUPAC name is Se-(3-oxobutyl) pyridine-2-carboselenoate.
Molecular Properties
| Compound Name | Se-(3-oxobutyl) pyridine-2-carboselenoate |
| PubChem CID | 58764813 |
| Molecular Formula | C10H11NO2Se |
| Molecular Weight | 256.16 g/mol |
| Exact Mass | 257.00 |
| IUPAC Name | Se-(3-oxobutyl) pyridine-2-carboselenoate |
| SMILES | CC(=O)CC[Se]C(=O)c1ccccn1 |
| InChI | InChI=1S/C10H11NO2Se/c1-8(12)5-7-14-10(13)9-4-2-3-6-11-9/h2-4,6H,5,7H2,1H3 |
| InChIKey | LNBKEVUDPYFTEG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.16 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Se-(3-oxobutyl) pyridine-2-carboselenoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Se-(3-oxobutyl) pyridine-2-carboselenoate?
The IUPAC name of Se-(3-oxobutyl) pyridine-2-carboselenoate (CID 58764813) is Se-(3-oxobutyl) pyridine-2-carboselenoate.
What is the SMILES notation for Se-(3-oxobutyl) pyridine-2-carboselenoate?
The canonical SMILES for Se-(3-oxobutyl) pyridine-2-carboselenoate is CC(=O)CC[Se]C(=O)c1ccccn1.
What is the InChIKey of Se-(3-oxobutyl) pyridine-2-carboselenoate?
The InChIKey is LNBKEVUDPYFTEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2Se/c1-8(12)5-7-14-10(13)9-4-2-3-6-11-9/h2-4,6H,5,7H2,1H3.
What are the key properties of Se-(3-oxobutyl) pyridine-2-carboselenoate?
Se-(3-oxobutyl) pyridine-2-carboselenoate has a molecular weight of 256.16 g/mol, XLogP of 1.32, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Se-(3-oxobutyl) pyridine-2-carboselenoate is sourced from PubChem (CID 58764813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).