About 1,2-dihydrotriazolo[4,5-b]pyridin-3-yl propan-2-yl carbonate
1,2-dihydrotriazolo[4,5-b]pyridin-3-yl propan-2-yl carbonate (PubChem CID 58769163) has the molecular formula C9H12N4O3
and a molecular weight of 224.22 g/mol. Its IUPAC name is 1,2-dihydrotriazolo[4,5-b]pyridin-3-yl propan-2-yl carbonate.
Analyze 1,2-dihydrotriazolo[4,5-b]pyridin-3-yl propan-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydrotriazolo[4,5-b]pyridin-3-yl propan-2-yl carbonate?
The IUPAC name of 1,2-dihydrotriazolo[4,5-b]pyridin-3-yl propan-2-yl carbonate (CID 58769163) is 1,2-dihydrotriazolo[4,5-b]pyridin-3-yl propan-2-yl carbonate.
What is the SMILES notation for 1,2-dihydrotriazolo[4,5-b]pyridin-3-yl propan-2-yl carbonate?
The canonical SMILES for 1,2-dihydrotriazolo[4,5-b]pyridin-3-yl propan-2-yl carbonate is CC(C)OC(=O)ON1NNc2cccnc21.
What is the InChIKey of 1,2-dihydrotriazolo[4,5-b]pyridin-3-yl propan-2-yl carbonate?
The InChIKey is BJZFOCBJNTWEGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O3/c1-6(2)15-9(14)16-13-8-7(11-12-13)4-3-5-10-8/h3-6,11-12H,1-2H3.
What are the key properties of 1,2-dihydrotriazolo[4,5-b]pyridin-3-yl propan-2-yl carbonate?
1,2-dihydrotriazolo[4,5-b]pyridin-3-yl propan-2-yl carbonate has a molecular weight of 224.22 g/mol, XLogP of 1.21, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydrotriazolo[4,5-b]pyridin-3-yl propan-2-yl carbonate is sourced from PubChem (CID 58769163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).